(2-Hydroxypropyl)-Beta-Cyclodextrin (HPBCD), 99.5% min., 100 grams
Specifications
| Return Shipping Will Be Paid By | Buyer |
| All Returns Accepted | Returns Accepted |
| Item Must Be Returned Within | 30 Days |
| Refund Will Be Given As | Money Back |
| Brand | Lisaexpert |
| MPN | 0001235 |
Hydroxypropyl-beta-CyclodextrinOther name: HP-β -CD or (2-Hydroxypropyl)-Beta-Cyclodextrin 1. Appearance: Hydroxypropyl-beta-Cyclodextrin is white powder, sweet, insipid innocent and can be used in both medicine field and food field. 2. Molecular formula: C42H70-XO35(CH2CHOH-CH3)X; 3. Molecular weght: 1135+58X; 4. CAS No.: 128446-35-5; 5. Spec: 99%;